C24H22F8 — CID 121476289
5,5,6,6-tetrafluoro-1-propyl-4-[5,5,6,6-tetrafluoro-4-(4-propylphenyl)cyclohexa-1,3-dien-1-yl]cyclohexa-1,3-diene (PubChem CID 121476289) has the molecular formula C24H22F8 and a molecular weight of 462.42 g/mol. Its IUPAC name is 5,5,6,6-tetrafluoro-1-propyl-4-[5,5,6,6-tetrafluoro-4-(4-propylphenyl)cyclohexa-1,3-dien-1-yl]cyclohexa-1,3-diene.
| Compound Name | 5,5,6,6-tetrafluoro-1-propyl-4-[5,5,6,6-tetrafluoro-4-(4-propylphenyl)cyclohexa-1,3-dien-1-yl]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 121476289 |
| Molecular Formula | C24H22F8 |
| Molecular Weight | 462.42 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | 5,5,6,6-tetrafluoro-1-propyl-4-[5,5,6,6-tetrafluoro-4-(4-propylphenyl)cyclohexa-1,3-dien-1-yl]cyclohexa-1,3-diene |
| SMILES | CCCC1=CC=C(C2=CC=C(c3ccc(CCC)cc3)C(F)(F)C2(F)F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C24H22F8/c1-3-5-15-7-9-16(10-8-15)18-13-14-20(24(31,32)22(18,27)28)19-12-11-17(6-4-2)21(25,26)23(19,29)30/h7-14H,3-6H2,1-2H3 |
| InChIKey | KFOHVDTXDQZEPS-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.42 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|