C24H20F10 — CID 121476293
1-(2,3-difluoro-4-propylphenyl)-5,5,6,6-tetrafluoro-4-(5,5,6,6-tetrafluoro-4-propylcyclohexa-1,3-dien-1-yl)cyclohexa-1,3-diene (PubChem CID 121476293) has the molecular formula C24H20F10 and a molecular weight of 498.40 g/mol. Its IUPAC name is 1-(2,3-difluoro-4-propylphenyl)-5,5,6,6-tetrafluoro-4-(5,5,6,6-tetrafluoro-4-propylcyclohexa-1,3-dien-1-yl)cyclohexa-1,3-diene.
| Compound Name | 1-(2,3-difluoro-4-propylphenyl)-5,5,6,6-tetrafluoro-4-(5,5,6,6-tetrafluoro-4-propylcyclohexa-1,3-dien-1-yl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 121476293 |
| Molecular Formula | C24H20F10 |
| Molecular Weight | 498.40 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | 1-(2,3-difluoro-4-propylphenyl)-5,5,6,6-tetrafluoro-4-(5,5,6,6-tetrafluoro-4-propylcyclohexa-1,3-dien-1-yl)cyclohexa-1,3-diene |
| SMILES | CCCC1=CC=C(C2=CC=C(c3ccc(CCC)c(F)c3F)C(F)(F)C2(F)F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C24H20F10/c1-3-5-13-7-9-15(20(26)19(13)25)16-11-12-18(24(33,34)22(16,29)30)17-10-8-14(6-4-2)21(27,28)23(17,31)32/h7-12H,3-6H2,1-2H3 |
| InChIKey | HGQCIPGIINVGRO-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.40 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|