C19H20ClF5 — CID 121476172
1-(2-chloro-4-pentylphenyl)-5,5,6,6-tetrafluoro-4-(2-fluoroethyl)cyclohexa-1,3-diene (PubChem CID 121476172) has the molecular formula C19H20ClF5 and a molecular weight of 378.81 g/mol. Its IUPAC name is 1-(2-chloro-4-pentylphenyl)-5,5,6,6-tetrafluoro-4-(2-fluoroethyl)cyclohexa-1,3-diene.
| Compound Name | 1-(2-chloro-4-pentylphenyl)-5,5,6,6-tetrafluoro-4-(2-fluoroethyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 121476172 |
| Molecular Formula | C19H20ClF5 |
| Molecular Weight | 378.81 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 1-(2-chloro-4-pentylphenyl)-5,5,6,6-tetrafluoro-4-(2-fluoroethyl)cyclohexa-1,3-diene |
| SMILES | CCCCCc1ccc(C2=CC=C(CCF)C(F)(F)C2(F)F)c(Cl)c1 |
| InChI | InChI=1S/C19H20ClF5/c1-2-3-4-5-13-6-8-15(17(20)12-13)16-9-7-14(10-11-21)18(22,23)19(16,24)25/h6-9,12H,2-5,10-11H2,1H3 |
| InChIKey | HPQYXPNHHQMISJ-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.81 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|