C14H21Cl — CID 18417644
2,4-dibutyl-1-chlorobenzene (PubChem CID 18417644) has the molecular formula C14H21Cl and a molecular weight of 224.77 g/mol. Its IUPAC name is 2,4-dibutyl-1-chlorobenzene.
| Compound Name | 2,4-dibutyl-1-chlorobenzene |
|---|---|
| PubChem CID | 18417644 |
| Molecular Formula | C14H21Cl |
| Molecular Weight | 224.77 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 2,4-dibutyl-1-chlorobenzene |
| SMILES | CCCCc1ccc(Cl)c(CCCC)c1 |
| InChI | InChI=1S/C14H21Cl/c1-3-5-7-12-9-10-14(15)13(11-12)8-6-4-2/h9-11H,3-8H2,1-2H3 |
| InChIKey | NVHZMCWJJXFMSB-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.77 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |