C24H24Cl2O2 — CID 16741909
2-(2-chloro-4-hexylphenyl)-5-(2-chlorophenyl)benzene-1,4-diol (PubChem CID 16741909) has the molecular formula C24H24Cl2O2 and a molecular weight of 415.36 g/mol. Its IUPAC name is 2-(2-chloro-4-hexylphenyl)-5-(2-chlorophenyl)benzene-1,4-diol.
| Compound Name | 2-(2-chloro-4-hexylphenyl)-5-(2-chlorophenyl)benzene-1,4-diol |
|---|---|
| PubChem CID | 16741909 |
| Molecular Formula | C24H24Cl2O2 |
| Molecular Weight | 415.36 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 2-(2-chloro-4-hexylphenyl)-5-(2-chlorophenyl)benzene-1,4-diol |
| SMILES | CCCCCCc1ccc(-c2cc(O)c(-c3ccccc3Cl)cc2O)c(Cl)c1 |
| InChI | InChI=1S/C24H24Cl2O2/c1-2-3-4-5-8-16-11-12-18(22(26)13-16)20-15-23(27)19(14-24(20)28)17-9-6-7-10-21(17)25/h6-7,9-15,27-28H,2-5,8H2,1H3 |
| InChIKey | AKRLVRMWVCIELX-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.36 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|