About 2,7,9-Tripentylfluoren-9-ol
2,7,9-Tripentylfluoren-9-ol (PubChem CID 175293843) has the molecular formula C28H40O
and a molecular weight of 392.60 g/mol. Its IUPAC name is 2,7,9-tripentylfluoren-9-ol.
Molecular Properties
| Compound Name | 2,7,9-Tripentylfluoren-9-ol |
| PubChem CID | 175293843 |
| Molecular Formula | C28H40O |
| Molecular Weight | 392.60 g/mol |
| Exact Mass | 392.31 |
| IUPAC Name | 2,7,9-tripentylfluoren-9-ol |
| SMILES | CCCCCC1=CC2=C(C=C1)C3=C(C2(CCCCC)O)C=C(C=C3)CCCCC |
| InChI | InChI=1S/C28H40O/c1-4-7-10-13-22-15-17-24-25-18-16-23(14-11-8-5-2)21-27(25)28(29,26(24)20-22)19-12-9-6-3/h15-18,20-21,29H,4-14,19H2,1-3H3 |
| InChIKey | AJYHYIVJXCTDDI-UHFFFAOYSA-N |
| XLogP | 9.40 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | 423 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.60 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2,7,9-Tripentylfluoren-9-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7,9-Tripentylfluoren-9-ol?
The IUPAC name of 2,7,9-Tripentylfluoren-9-ol (CID 175293843) is 2,7,9-tripentylfluoren-9-ol.
What is the SMILES notation for 2,7,9-Tripentylfluoren-9-ol?
The canonical SMILES for 2,7,9-Tripentylfluoren-9-ol is CCCCCC1=CC2=C(C=C1)C3=C(C2(CCCCC)O)C=C(C=C3)CCCCC.
What is the InChIKey of 2,7,9-Tripentylfluoren-9-ol?
The InChIKey is AJYHYIVJXCTDDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H40O/c1-4-7-10-13-22-15-17-24-25-18-16-23(14-11-8-5-2)21-27(25)28(29,26(24)20-22)19-12-9-6-3/h15-18,20-21,29H,4-14,19H2,1-3H3.
What are the key properties of 2,7,9-Tripentylfluoren-9-ol?
2,7,9-Tripentylfluoren-9-ol has a molecular weight of 392.60 g/mol, XLogP of 9.40, 12 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7,9-Tripentylfluoren-9-ol is sourced from PubChem (CID 175293843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).