C20H32 — CID 23002530
6-hexyl-1,1,4,4-tetramethyl-2,3-dihydronaphthalene (PubChem CID 23002530) has the molecular formula C20H32 and a molecular weight of 272.48 g/mol. Its IUPAC name is 6-hexyl-1,1,4,4-tetramethyl-2,3-dihydronaphthalene.
| Compound Name | 6-hexyl-1,1,4,4-tetramethyl-2,3-dihydronaphthalene |
|---|---|
| PubChem CID | 23002530 |
| Molecular Formula | C20H32 |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.25 |
| IUPAC Name | 6-hexyl-1,1,4,4-tetramethyl-2,3-dihydronaphthalene |
| SMILES | CCCCCCc1ccc2c(c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C20H32/c1-6-7-8-9-10-16-11-12-17-18(15-16)20(4,5)14-13-19(17,2)3/h11-12,15H,6-10,13-14H2,1-5H3 |
| InChIKey | UQVKXTZXZXYDGA-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|