C21H25Br — CID 130398311
2-bromo-7-hexyl-9,9-dimethylfluorene (PubChem CID 130398311) has the molecular formula C21H25Br and a molecular weight of 357.34 g/mol. Its IUPAC name is 2-bromo-7-hexyl-9,9-dimethylfluorene.
| Compound Name | 2-bromo-7-hexyl-9,9-dimethylfluorene |
|---|---|
| PubChem CID | 130398311 |
| Molecular Formula | C21H25Br |
| Molecular Weight | 357.34 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 2-bromo-7-hexyl-9,9-dimethylfluorene |
| SMILES | CCCCCCc1ccc2c(c1)C(C)(C)c1cc(Br)ccc1-2 |
| InChI | InChI=1S/C21H25Br/c1-4-5-6-7-8-15-9-11-17-18-12-10-16(22)14-20(18)21(2,3)19(17)13-15/h9-14H,4-8H2,1-3H3 |
| InChIKey | DVIFODIWKRCHEZ-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.34 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|