About 2-(5-bromopentyl)-7-hexyl-9,9-dimethylxanthene
2-(5-bromopentyl)-7-hexyl-9,9-dimethylxanthene (PubChem CID 86046550) has the molecular formula C26H35BrO
and a molecular weight of 443.47 g/mol. Its IUPAC name is 2-(5-bromopentyl)-7-hexyl-9,9-dimethylxanthene.
Molecular Properties
| Compound Name | 2-(5-bromopentyl)-7-hexyl-9,9-dimethylxanthene |
| PubChem CID | 86046550 |
| Molecular Formula | C26H35BrO |
| Molecular Weight | 443.47 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 2-(5-bromopentyl)-7-hexyl-9,9-dimethylxanthene |
| SMILES | CCCCCCc1ccc2c(c1)C(C)(C)c1cc(CCCCCBr)ccc1O2 |
| InChI | InChI=1S/C26H35BrO/c1-4-5-6-8-11-20-13-15-24-22(18-20)26(2,3)23-19-21(12-9-7-10-17-27)14-16-25(23)28-24/h13-16,18-19H,4-12,17H2,1-3H3 |
| InChIKey | XMHBHYSDMUGKPK-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 443.47 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-bromopentyl)-7-hexyl-9,9-dimethylxanthene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-bromopentyl)-7-hexyl-9,9-dimethylxanthene?
The IUPAC name of 2-(5-bromopentyl)-7-hexyl-9,9-dimethylxanthene (CID 86046550) is 2-(5-bromopentyl)-7-hexyl-9,9-dimethylxanthene.
What is the SMILES notation for 2-(5-bromopentyl)-7-hexyl-9,9-dimethylxanthene?
The canonical SMILES for 2-(5-bromopentyl)-7-hexyl-9,9-dimethylxanthene is CCCCCCc1ccc2c(c1)C(C)(C)c1cc(CCCCCBr)ccc1O2.
What is the InChIKey of 2-(5-bromopentyl)-7-hexyl-9,9-dimethylxanthene?
The InChIKey is XMHBHYSDMUGKPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H35BrO/c1-4-5-6-8-11-20-13-15-24-22(18-20)26(2,3)23-19-21(12-9-7-10-17-27)14-16-25(23)28-24/h13-16,18-19H,4-12,17H2,1-3H3.
What are the key properties of 2-(5-bromopentyl)-7-hexyl-9,9-dimethylxanthene?
2-(5-bromopentyl)-7-hexyl-9,9-dimethylxanthene has a molecular weight of 443.47 g/mol, XLogP of 8.35, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-bromopentyl)-7-hexyl-9,9-dimethylxanthene is sourced from PubChem (CID 86046550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).