C23H34O — CID 173323218
(E)-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)non-2-enal (PubChem CID 173323218) has the molecular formula C23H34O and a molecular weight of 326.52 g/mol. Its IUPAC name is (E)-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)non-2-enal.
| Compound Name | (E)-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)non-2-enal |
|---|---|
| PubChem CID | 173323218 |
| Molecular Formula | C23H34O |
| Molecular Weight | 326.52 g/mol |
| Exact Mass | 326.26 |
| IUPAC Name | (E)-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)non-2-enal |
| SMILES | CCCCCC/C=C(/C=O)c1ccc2c(c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C23H34O/c1-6-7-8-9-10-11-19(17-24)18-12-13-20-21(16-18)23(4,5)15-14-22(20,2)3/h11-13,16-17H,6-10,14-15H2,1-5H3/b19-11- |
| InChIKey | CLTZKTDFHVPSRJ-ODLFYWEKSA-N |
| XLogP | 6.59 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.52 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|