C32H43NO3 — CID 67559413
2-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)undec-2-enoylamino]benzoic acid (PubChem CID 67559413) has the molecular formula C32H43NO3 and a molecular weight of 489.70 g/mol. Its IUPAC name is 2-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)undec-2-enoylamino]benzoic acid.
| Compound Name | 2-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)undec-2-enoylamino]benzoic acid |
|---|---|
| PubChem CID | 67559413 |
| Molecular Formula | C32H43NO3 |
| Molecular Weight | 489.70 g/mol |
| Exact Mass | 489.32 |
| IUPAC Name | 2-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)undec-2-enoylamino]benzoic acid |
| SMILES | CCCCCCCCC=C(C(=O)Nc1ccccc1C(=O)O)c1ccc2c(c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C32H43NO3/c1-6-7-8-9-10-11-12-15-24(29(34)33-28-17-14-13-16-25(28)30(35)36)23-18-19-26-27(22-23)32(4,5)21-20-31(26,2)3/h13-19,22H,6-12,20-21H2,1-5H3,(H,33,34)(H,35,36) |
| InChIKey | BGSJIXWMKZONGV-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.70 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|