C23H34O2 — CID 70217965
(E)-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)non-2-enoic acid (PubChem CID 70217965) has the molecular formula C23H34O2 and a molecular weight of 342.52 g/mol. Its IUPAC name is (E)-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)non-2-enoic acid.
| Compound Name | (E)-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)non-2-enoic acid |
|---|---|
| PubChem CID | 70217965 |
| Molecular Formula | C23H34O2 |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | (E)-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)non-2-enoic acid |
| SMILES | CCCCCC/C=C(/C(=O)O)c1ccc2c(c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C23H34O2/c1-6-7-8-9-10-11-18(21(24)25)17-12-13-19-20(16-17)23(4,5)15-14-22(19,2)3/h11-13,16H,6-10,14-15H2,1-5H3,(H,24,25)/b18-11+ |
| InChIKey | FIRPQROFHOWVAG-WOJGMQOQSA-N |
| XLogP | 6.47 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|