C27H37NO2 — CID 139786105
4-[hexyl-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)amino]benzoic acid (PubChem CID 139786105) has the molecular formula C27H37NO2 and a molecular weight of 407.60 g/mol. Its IUPAC name is 4-[hexyl-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)amino]benzoic acid.
| Compound Name | 4-[hexyl-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)amino]benzoic acid |
|---|---|
| PubChem CID | 139786105 |
| Molecular Formula | C27H37NO2 |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.28 |
| IUPAC Name | 4-[hexyl-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)amino]benzoic acid |
| SMILES | CCCCCCN(c1ccc(C(=O)O)cc1)c1ccc2c(c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C27H37NO2/c1-6-7-8-9-18-28(21-12-10-20(11-13-21)25(29)30)22-14-15-23-24(19-22)27(4,5)17-16-26(23,2)3/h10-15,19H,6-9,16-18H2,1-5H3,(H,29,30) |
| InChIKey | ZNVGXEFROXHLFS-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|