C32H52O2 — CID 176888341
(Z)-18-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)octadec-9-enoic acid (PubChem CID 176888341) has the molecular formula C32H52O2 and a molecular weight of 468.77 g/mol. Its IUPAC name is (Z)-18-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)octadec-9-enoic acid.
| Compound Name | (Z)-18-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)octadec-9-enoic acid |
|---|---|
| PubChem CID | 176888341 |
| Molecular Formula | C32H52O2 |
| Molecular Weight | 468.77 g/mol |
| Exact Mass | 468.40 |
| IUPAC Name | (Z)-18-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)octadec-9-enoic acid |
| SMILES | CC1(C)CCC(C)(C)c2cc(CCCCCCCC/C=C\CCCCCCCC(=O)O)ccc21 |
| InChI | InChI=1S/C32H52O2/c1-31(2)24-25-32(3,4)29-26-27(22-23-28(29)31)20-18-16-14-12-10-8-6-5-7-9-11-13-15-17-19-21-30(33)34/h5,7,22-23,26H,6,8-21,24-25H2,1-4H3,(H,33,34)/b7-5- |
| InChIKey | UBMSFLMFZCTQSU-ALCCZGGFSA-N |
| XLogP | 9.68 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.77 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|