C17H24O3 — CID 139839105
4-[4-hydroxy-3-(1-methylcyclohexyl)phenyl]butanoic acid (PubChem CID 139839105) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is 4-[4-hydroxy-3-(1-methylcyclohexyl)phenyl]butanoic acid.
| Compound Name | 4-[4-hydroxy-3-(1-methylcyclohexyl)phenyl]butanoic acid |
|---|---|
| PubChem CID | 139839105 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 4-[4-hydroxy-3-(1-methylcyclohexyl)phenyl]butanoic acid |
| SMILES | CC1(c2cc(CCCC(=O)O)ccc2O)CCCCC1 |
| InChI | InChI=1S/C17H24O3/c1-17(10-3-2-4-11-17)14-12-13(8-9-15(14)18)6-5-7-16(19)20/h8-9,12,18H,2-7,10-11H2,1H3,(H,19,20) |
| InChIKey | JBVJPEARXKSSBO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |