C28H40O4 — CID 88655341
(E)-18-(4-methyl-2-oxochromen-7-yl)octadec-9-enoic acid (PubChem CID 88655341) has the molecular formula C28H40O4 and a molecular weight of 440.62 g/mol. Its IUPAC name is (E)-18-(4-methyl-2-oxochromen-7-yl)octadec-9-enoic acid.
| Compound Name | (E)-18-(4-methyl-2-oxochromen-7-yl)octadec-9-enoic acid |
|---|---|
| PubChem CID | 88655341 |
| Molecular Formula | C28H40O4 |
| Molecular Weight | 440.62 g/mol |
| Exact Mass | 440.29 |
| IUPAC Name | (E)-18-(4-methyl-2-oxochromen-7-yl)octadec-9-enoic acid |
| SMILES | Cc1cc(=O)oc2cc(CCCCCCCC/C=C/CCCCCCCC(=O)O)ccc12 |
| InChI | InChI=1S/C28H40O4/c1-23-21-28(31)32-26-22-24(19-20-25(23)26)17-15-13-11-9-7-5-3-2-4-6-8-10-12-14-16-18-27(29)30/h2,4,19-22H,3,5-18H2,1H3,(H,29,30)/b4-2+ |
| InChIKey | RCJUULDXXNQROC-DUXPYHPUSA-N |
| XLogP | 7.75 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.62 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|