C29H34O3 — CID 19920651
ethyl 3-[(2Z,4E)-1-oxo-5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)hexa-2,4-dien-2-yl]benzoate (PubChem CID 19920651) has the molecular formula C29H34O3 and a molecular weight of 430.59 g/mol. Its IUPAC name is ethyl 3-[(2Z,4E)-1-oxo-5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)hexa-2,4-dien-2-yl]benzoate.
| Compound Name | ethyl 3-[(2Z,4E)-1-oxo-5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)hexa-2,4-dien-2-yl]benzoate |
|---|---|
| PubChem CID | 19920651 |
| Molecular Formula | C29H34O3 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | ethyl 3-[(2Z,4E)-1-oxo-5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)hexa-2,4-dien-2-yl]benzoate |
| SMILES | CCOC(=O)c1cccc(/C(C=O)=C/C=C(\C)c2ccc3c(c2)C(C)(C)CCC3(C)C)c1 |
| InChI | InChI=1S/C29H34O3/c1-7-32-27(31)23-10-8-9-22(17-23)24(19-30)12-11-20(2)21-13-14-25-26(18-21)29(5,6)16-15-28(25,3)4/h8-14,17-19H,7,15-16H2,1-6H3/b20-11+,24-12+ |
| InChIKey | FSTYQYATYZQRCM-MCORFEDZSA-N |
| XLogP | 6.90 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|