C22H28O2S — CID 54436112
ethyl 7-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)-3-methylocta-2,4,6-trienoate (PubChem CID 54436112) has the molecular formula C22H28O2S and a molecular weight of 356.53 g/mol. Its IUPAC name is ethyl 7-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)-3-methylocta-2,4,6-trienoate.
| Compound Name | ethyl 7-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)-3-methylocta-2,4,6-trienoate |
|---|---|
| PubChem CID | 54436112 |
| Molecular Formula | C22H28O2S |
| Molecular Weight | 356.53 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | ethyl 7-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)-3-methylocta-2,4,6-trienoate |
| SMILES | CCOC(=O)C=C(C)C=CC=C(C)c1ccc2c(c1)C(C)(C)CCS2 |
| InChI | InChI=1S/C22H28O2S/c1-6-24-21(23)14-16(2)8-7-9-17(3)18-10-11-20-19(15-18)22(4,5)12-13-25-20/h7-11,14-15H,6,12-13H2,1-5H3 |
| InChIKey | WKVFYYUDAKPCPT-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.53 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|