C22H21FO2S — CID 130417687
ethyl 4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]-3-fluorobenzoate (PubChem CID 130417687) has the molecular formula C22H21FO2S and a molecular weight of 368.47 g/mol. Its IUPAC name is ethyl 4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]-3-fluorobenzoate.
| Compound Name | ethyl 4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]-3-fluorobenzoate |
|---|---|
| PubChem CID | 130417687 |
| Molecular Formula | C22H21FO2S |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | ethyl 4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]-3-fluorobenzoate |
| SMILES | CCOC(=O)c1ccc(C#Cc2ccc3c(c2)C(C)(C)CCS3)c(F)c1 |
| InChI | InChI=1S/C22H21FO2S/c1-4-25-21(24)17-9-8-16(19(23)14-17)7-5-15-6-10-20-18(13-15)22(2,3)11-12-26-20/h6,8-10,13-14H,4,11-12H2,1-3H3 |
| InChIKey | CDJHTSGHHLXPDO-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|