C28H34O2S — CID 15296880
ethyl 4-[2-(4,4-dibutyl-2,3-dihydrothiochromen-6-yl)ethynyl]benzoate (PubChem CID 15296880) has the molecular formula C28H34O2S and a molecular weight of 434.65 g/mol. Its IUPAC name is ethyl 4-[2-(4,4-dibutyl-2,3-dihydrothiochromen-6-yl)ethynyl]benzoate.
| Compound Name | ethyl 4-[2-(4,4-dibutyl-2,3-dihydrothiochromen-6-yl)ethynyl]benzoate |
|---|---|
| PubChem CID | 15296880 |
| Molecular Formula | C28H34O2S |
| Molecular Weight | 434.65 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | ethyl 4-[2-(4,4-dibutyl-2,3-dihydrothiochromen-6-yl)ethynyl]benzoate |
| SMILES | CCCCC1(CCCC)CCSc2ccc(C#Cc3ccc(C(=O)OCC)cc3)cc21 |
| InChI | InChI=1S/C28H34O2S/c1-4-7-17-28(18-8-5-2)19-20-31-26-16-13-23(21-25(26)28)10-9-22-11-14-24(15-12-22)27(29)30-6-3/h11-16,21H,4-8,17-20H2,1-3H3 |
| InChIKey | VLKRQGSALTUJBS-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.65 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|