About ethyl 4-[2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]benzoate
ethyl 4-[2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]benzoate (PubChem CID 57172062) has the molecular formula C22H22O3S2
and a molecular weight of 398.55 g/mol. Its IUPAC name is ethyl 4-[2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]benzoate.
Molecular Properties
| Compound Name | ethyl 4-[2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]benzoate |
| PubChem CID | 57172062 |
| Molecular Formula | C22H22O3S2 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | ethyl 4-[2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]benzoate |
| SMILES | CCOC(=O)c1ccc(C#Cc2ccc3c(c2)C(SC)(SC)CCO3)cc1 |
| InChI | InChI=1S/C22H22O3S2/c1-4-24-21(23)18-10-7-16(8-11-18)5-6-17-9-12-20-19(15-17)22(26-2,27-3)13-14-25-20/h7-12,15H,4,13-14H2,1-3H3 |
| InChIKey | XZWILFUXZZLWQF-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-[2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]benzoate?
The IUPAC name of ethyl 4-[2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]benzoate (CID 57172062) is ethyl 4-[2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]benzoate.
What is the SMILES notation for ethyl 4-[2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]benzoate?
The canonical SMILES for ethyl 4-[2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]benzoate is CCOC(=O)c1ccc(C#Cc2ccc3c(c2)C(SC)(SC)CCO3)cc1.
What is the InChIKey of ethyl 4-[2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]benzoate?
The InChIKey is XZWILFUXZZLWQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22O3S2/c1-4-24-21(23)18-10-7-16(8-11-18)5-6-17-9-12-20-19(15-17)22(26-2,27-3)13-14-25-20/h7-12,15H,4,13-14H2,1-3H3.
What are the key properties of ethyl 4-[2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]benzoate?
ethyl 4-[2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]benzoate has a molecular weight of 398.55 g/mol, XLogP of 4.92, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]benzoate is sourced from PubChem (CID 57172062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).