C22H22O3S2 — CID 57172062
ethyl 4-[2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]benzoate (PubChem CID 57172062) has the molecular formula C22H22O3S2 and a molecular weight of 398.55 g/mol. Its IUPAC name is ethyl 4-[2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]benzoate.
| Compound Name | ethyl 4-[2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]benzoate |
|---|---|
| PubChem CID | 57172062 |
| Molecular Formula | C22H22O3S2 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | ethyl 4-[2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]benzoate |
| SMILES | CCOC(=O)c1ccc(C#Cc2ccc3c(c2)C(SC)(SC)CCO3)cc1 |
| InChI | InChI=1S/C22H22O3S2/c1-4-24-21(23)18-10-7-16(8-11-18)5-6-17-9-12-20-19(15-17)22(26-2,27-3)13-14-25-20/h7-12,15H,4,13-14H2,1-3H3 |
| InChIKey | XZWILFUXZZLWQF-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|