C22H20F2O3S2 — CID 137404744
ethyl 4-[2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]-2,3-difluorobenzoate (PubChem CID 137404744) has the molecular formula C22H20F2O3S2 and a molecular weight of 434.53 g/mol. Its IUPAC name is ethyl 4-[2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]-2,3-difluorobenzoate.
| Compound Name | ethyl 4-[2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]-2,3-difluorobenzoate |
|---|---|
| PubChem CID | 137404744 |
| Molecular Formula | C22H20F2O3S2 |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | ethyl 4-[2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]-2,3-difluorobenzoate |
| SMILES | CCOC(=O)c1ccc(C#Cc2ccc3c(c2)C(SC)(SC)CCO3)c(F)c1F |
| InChI | InChI=1S/C22H20F2O3S2/c1-4-26-21(25)16-9-8-15(19(23)20(16)24)7-5-14-6-10-18-17(13-14)22(28-2,29-3)11-12-27-18/h6,8-10,13H,4,11-12H2,1-3H3 |
| InChIKey | HZTMVAYBVICQJK-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|