C24H25NO4S2 — CID 137404701
ethyl 2-acetamido-4-[2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]benzoate (PubChem CID 137404701) has the molecular formula C24H25NO4S2 and a molecular weight of 455.60 g/mol. Its IUPAC name is ethyl 2-acetamido-4-[2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]benzoate.
| Compound Name | ethyl 2-acetamido-4-[2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]benzoate |
|---|---|
| PubChem CID | 137404701 |
| Molecular Formula | C24H25NO4S2 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | ethyl 2-acetamido-4-[2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]benzoate |
| SMILES | CCOC(=O)c1ccc(C#Cc2ccc3c(c2)C(SC)(SC)CCO3)cc1NC(C)=O |
| InChI | InChI=1S/C24H25NO4S2/c1-5-28-23(27)19-10-8-18(15-21(19)25-16(2)26)7-6-17-9-11-22-20(14-17)24(30-3,31-4)12-13-29-22/h8-11,14-15H,5,12-13H2,1-4H3,(H,25,26) |
| InChIKey | NXBIBOOGLGFZPT-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|