C20H20N2O3S2 — CID 137404743
ethyl 5-[2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]pyrimidine-2-carboxylate (PubChem CID 137404743) has the molecular formula C20H20N2O3S2 and a molecular weight of 400.53 g/mol. Its IUPAC name is ethyl 5-[2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]pyrimidine-2-carboxylate.
| Compound Name | ethyl 5-[2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 137404743 |
| Molecular Formula | C20H20N2O3S2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | ethyl 5-[2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]pyrimidine-2-carboxylate |
| SMILES | CCOC(=O)c1ncc(C#Cc2ccc3c(c2)C(SC)(SC)CCO3)cn1 |
| InChI | InChI=1S/C20H20N2O3S2/c1-4-24-19(23)18-21-12-15(13-22-18)6-5-14-7-8-17-16(11-14)20(26-2,27-3)9-10-25-17/h7-8,11-13H,4,9-10H2,1-3H3 |
| InChIKey | DQMXZJFUPCTTMO-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|