C20H20N2O3S — CID 130417691
ethyl 5-[2-(4,4-dimethyl-1-oxo-2,3-dihydrothiochromen-6-yl)ethynyl]pyrimidine-2-carboxylate (PubChem CID 130417691) has the molecular formula C20H20N2O3S and a molecular weight of 368.46 g/mol. Its IUPAC name is ethyl 5-[2-(4,4-dimethyl-1-oxo-2,3-dihydrothiochromen-6-yl)ethynyl]pyrimidine-2-carboxylate.
| Compound Name | ethyl 5-[2-(4,4-dimethyl-1-oxo-2,3-dihydrothiochromen-6-yl)ethynyl]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 130417691 |
| Molecular Formula | C20H20N2O3S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | ethyl 5-[2-(4,4-dimethyl-1-oxo-2,3-dihydrothiochromen-6-yl)ethynyl]pyrimidine-2-carboxylate |
| SMILES | CCOC(=O)c1ncc(C#Cc2ccc3c(c2)C(C)(C)CCS3=O)cn1 |
| InChI | InChI=1S/C20H20N2O3S/c1-4-25-19(23)18-21-12-15(13-22-18)6-5-14-7-8-17-16(11-14)20(2,3)9-10-26(17)24/h7-8,11-13H,4,9-10H2,1-3H3 |
| InChIKey | FJRFHVCXRUYMEZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|