C48H50N2O7S2 — CID 160816797
ethyl 3-acetamido-4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]benzoate;ethyl 3-acetamido-4-[2-(4,4-dimethyl-1-oxo-2,3-dihydrothiochromen-6-yl)ethynyl]benzoate (PubChem CID 160816797) has the molecular formula C48H50N2O7S2 and a molecular weight of 831.07 g/mol. Its IUPAC name is ethyl 3-acetamido-4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]benzoate;ethyl 3-acetamido-4-[2-(4,4-dimethyl-1-oxo-2,3-dihydrothiochromen-6-yl)ethynyl]benzoate.
| Compound Name | ethyl 3-acetamido-4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]benzoate;ethyl 3-acetamido-4-[2-(4,4-dimethyl-1-oxo-2,3-dihydrothiochromen-6-yl)ethynyl]benzoate |
|---|---|
| PubChem CID | 160816797 |
| Molecular Formula | C48H50N2O7S2 |
| Molecular Weight | 831.07 g/mol |
| Exact Mass | 830.31 |
| IUPAC Name | ethyl 3-acetamido-4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]benzoate;ethyl 3-acetamido-4-[2-(4,4-dimethyl-1-oxo-2,3-dihydrothiochromen-6-yl)ethynyl]benzoate |
| SMILES | CCOC(=O)c1ccc(C#Cc2ccc3c(c2)C(C)(C)CCS3)c(NC(C)=O)c1.CCOC(=O)c1ccc(C#Cc2ccc3c(c2)C(C)(C)CCS3=O)c(NC(C)=O)c1 |
| InChI | InChI=1S/C24H25NO4S.C24H25NO3S/c1-5-29-23(27)19-10-9-18(21(15-19)25-16(2)26)8-6-17-7-11-22-20(14-17)24(3,4)12-13-30(22)28;1-5-28-23(27)19-10-9-18(21(15-19)25-16(2)26)8-6-17-7-11-22-20(14-17)24(3,4)12-13-29-22/h7,9-11,14-15H,5,12-13H2,1-4H3,(H,25,26);7,9-11,14-15H,5,12-13H2,1-4H3,(H,25,26) |
| InChIKey | SEZWANIGGYHKDU-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.07 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|