C21H21NO2S — CID 130417672
methyl 2-amino-4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]benzoate (PubChem CID 130417672) has the molecular formula C21H21NO2S and a molecular weight of 351.47 g/mol. Its IUPAC name is methyl 2-amino-4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]benzoate.
| Compound Name | methyl 2-amino-4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]benzoate |
|---|---|
| PubChem CID | 130417672 |
| Molecular Formula | C21H21NO2S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | methyl 2-amino-4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]benzoate |
| SMILES | COC(=O)c1ccc(C#Cc2ccc3c(c2)C(C)(C)CCS3)cc1N |
| InChI | InChI=1S/C21H21NO2S/c1-21(2)10-11-25-19-9-7-14(12-17(19)21)4-5-15-6-8-16(18(22)13-15)20(23)24-3/h6-9,12-13H,10-11,22H2,1-3H3 |
| InChIKey | MOSRUEPGTPJTFJ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|