C19H17N2O2S- — CID 19975549
2-[5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrimidin-2-yl]acetate (PubChem CID 19975549) has the molecular formula C19H17N2O2S- and a molecular weight of 337.42 g/mol. Its IUPAC name is 2-[5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrimidin-2-yl]acetate.
| Compound Name | 2-[5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrimidin-2-yl]acetate |
|---|---|
| PubChem CID | 19975549 |
| Molecular Formula | C19H17N2O2S- |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 2-[5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrimidin-2-yl]acetate |
| SMILES | CC1(C)CCSc2ccc(C#Cc3cnc(CC(=O)[O-])nc3)cc21 |
| InChI | InChI=1S/C19H18N2O2S/c1-19(2)7-8-24-16-6-5-13(9-15(16)19)3-4-14-11-20-17(21-12-14)10-18(22)23/h5-6,9,11-12H,7-8,10H2,1-2H3,(H,22,23)/p-1 |
| InChIKey | AZILSEYEYYTHDR-UHFFFAOYSA-M |
| XLogP | 1.94 |
| TPSA | 65.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|