C27H34N2O2S — CID 18947751
ethyl 2-[5-[2-(7-hexyl-4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrimidin-2-yl]acetate (PubChem CID 18947751) has the molecular formula C27H34N2O2S and a molecular weight of 450.65 g/mol. Its IUPAC name is ethyl 2-[5-[2-(7-hexyl-4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrimidin-2-yl]acetate.
| Compound Name | ethyl 2-[5-[2-(7-hexyl-4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrimidin-2-yl]acetate |
|---|---|
| PubChem CID | 18947751 |
| Molecular Formula | C27H34N2O2S |
| Molecular Weight | 450.65 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | ethyl 2-[5-[2-(7-hexyl-4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrimidin-2-yl]acetate |
| SMILES | CCCCCCc1cc2c(cc1C#Cc1cnc(CC(=O)OCC)nc1)C(C)(C)CCS2 |
| InChI | InChI=1S/C27H34N2O2S/c1-5-7-8-9-10-21-16-24-23(27(3,4)13-14-32-24)15-22(21)12-11-20-18-28-25(29-19-20)17-26(30)31-6-2/h15-16,18-19H,5-10,13-14,17H2,1-4H3 |
| InChIKey | NEGZNMPMAYWMEJ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.65 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|