C22H22O2S — CID 157170321
1-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]-2-methoxyphenyl]ethanone (PubChem CID 157170321) has the molecular formula C22H22O2S and a molecular weight of 350.48 g/mol. Its IUPAC name is 1-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]-2-methoxyphenyl]ethanone.
| Compound Name | 1-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]-2-methoxyphenyl]ethanone |
|---|---|
| PubChem CID | 157170321 |
| Molecular Formula | C22H22O2S |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 1-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]-2-methoxyphenyl]ethanone |
| SMILES | COc1cc(C#Cc2ccc3c(c2)C(C)(C)CCS3)ccc1C(C)=O |
| InChI | InChI=1S/C22H22O2S/c1-15(23)18-9-7-17(14-20(18)24-4)6-5-16-8-10-21-19(13-16)22(2,3)11-12-25-21/h7-10,13-14H,11-12H2,1-4H3 |
| InChIKey | MIDYHILIMYFZTI-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|