C19H18N2OS — CID 157266034
1-[5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrazin-2-yl]ethanone (PubChem CID 157266034) has the molecular formula C19H18N2OS and a molecular weight of 322.43 g/mol. Its IUPAC name is 1-[5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrazin-2-yl]ethanone.
| Compound Name | 1-[5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrazin-2-yl]ethanone |
|---|---|
| PubChem CID | 157266034 |
| Molecular Formula | C19H18N2OS |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 1-[5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrazin-2-yl]ethanone |
| SMILES | CC(=O)c1cnc(C#Cc2ccc3c(c2)C(C)(C)CCS3)cn1 |
| InChI | InChI=1S/C19H18N2OS/c1-13(22)17-12-20-15(11-21-17)6-4-14-5-7-18-16(10-14)19(2,3)8-9-23-18/h5,7,10-12H,8-9H2,1-3H3 |
| InChIKey | DQWWAYSYLMBZCD-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|