C28H27NO4S — CID 66870691
benzoic acid;ethyl 6-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyridine-3-carboxylate (PubChem CID 66870691) has the molecular formula C28H27NO4S and a molecular weight of 473.59 g/mol. Its IUPAC name is benzoic acid;ethyl 6-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyridine-3-carboxylate.
| Compound Name | benzoic acid;ethyl 6-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 66870691 |
| Molecular Formula | C28H27NO4S |
| Molecular Weight | 473.59 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | benzoic acid;ethyl 6-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(C#Cc2ccc3c(c2)C(C)(C)CCS3)nc1.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C21H21NO2S.C7H6O2/c1-4-24-20(23)16-7-9-17(22-14-16)8-5-15-6-10-19-18(13-15)21(2,3)11-12-25-19;8-7(9)6-4-2-1-3-5-6/h6-7,9-10,13-14H,4,11-12H2,1-3H3;1-5H,(H,8,9) |
| InChIKey | PCFJJWFFIOHIGQ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.59 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|