C22H26N2O2S — CID 145364677
ethane;ethyl 5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrazine-2-carboxylate (PubChem CID 145364677) has the molecular formula C22H26N2O2S and a molecular weight of 382.53 g/mol. Its IUPAC name is ethane;ethyl 5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrazine-2-carboxylate.
| Compound Name | ethane;ethyl 5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 145364677 |
| Molecular Formula | C22H26N2O2S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | ethane;ethyl 5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrazine-2-carboxylate |
| SMILES | CC.CCOC(=O)c1cnc(C#Cc2ccc3c(c2)C(C)(C)CCS3)cn1 |
| InChI | InChI=1S/C20H20N2O2S.C2H6/c1-4-24-19(23)17-13-21-15(12-22-17)7-5-14-6-8-18-16(11-14)20(2,3)9-10-25-18;1-2/h6,8,11-13H,4,9-10H2,1-3H3;1-2H3 |
| InChIKey | SJZNCUSOCXKOMT-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|