C22H23NO2S — CID 145364694
ethyl 3-amino-4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]benzoate (PubChem CID 145364694) has the molecular formula C22H23NO2S and a molecular weight of 365.50 g/mol. Its IUPAC name is ethyl 3-amino-4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]benzoate.
| Compound Name | ethyl 3-amino-4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]benzoate |
|---|---|
| PubChem CID | 145364694 |
| Molecular Formula | C22H23NO2S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | ethyl 3-amino-4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]benzoate |
| SMILES | CCOC(=O)c1ccc(C#Cc2ccc3c(c2)C(C)(C)CCS3)c(N)c1 |
| InChI | InChI=1S/C22H23NO2S/c1-4-25-21(24)17-9-8-16(19(23)14-17)7-5-15-6-10-20-18(13-15)22(2,3)11-12-26-20/h6,8-10,13-14H,4,11-12,23H2,1-3H3 |
| InChIKey | KFDZKJKPWRCFLD-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|