C21H22O3S3 — CID 57074270
ethyl 2-[5-[2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]thiophen-2-yl]acetate (PubChem CID 57074270) has the molecular formula C21H22O3S3 and a molecular weight of 418.61 g/mol. Its IUPAC name is ethyl 2-[5-[2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]thiophen-2-yl]acetate.
| Compound Name | ethyl 2-[5-[2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]thiophen-2-yl]acetate |
|---|---|
| PubChem CID | 57074270 |
| Molecular Formula | C21H22O3S3 |
| Molecular Weight | 418.61 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | ethyl 2-[5-[2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]thiophen-2-yl]acetate |
| SMILES | CCOC(=O)Cc1ccc(C#Cc2ccc3c(c2)C(SC)(SC)CCO3)s1 |
| InChI | InChI=1S/C21H22O3S3/c1-4-23-20(22)14-17-9-8-16(27-17)7-5-15-6-10-19-18(13-15)21(25-2,26-3)11-12-24-19/h6,8-10,13H,4,11-12,14H2,1-3H3 |
| InChIKey | LRHOBHDYBBCFEI-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.61 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|