C25H28O3 — CID 23174303
ethyl 2-[4-[2-(2,2,4,4-tetramethyl-3H-chromen-6-yl)ethynyl]phenyl]acetate (PubChem CID 23174303) has the molecular formula C25H28O3 and a molecular weight of 376.50 g/mol. Its IUPAC name is ethyl 2-[4-[2-(2,2,4,4-tetramethyl-3H-chromen-6-yl)ethynyl]phenyl]acetate.
| Compound Name | ethyl 2-[4-[2-(2,2,4,4-tetramethyl-3H-chromen-6-yl)ethynyl]phenyl]acetate |
|---|---|
| PubChem CID | 23174303 |
| Molecular Formula | C25H28O3 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | ethyl 2-[4-[2-(2,2,4,4-tetramethyl-3H-chromen-6-yl)ethynyl]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(C#Cc2ccc3c(c2)C(C)(C)CC(C)(C)O3)cc1 |
| InChI | InChI=1S/C25H28O3/c1-6-27-23(26)16-20-11-8-18(9-12-20)7-10-19-13-14-22-21(15-19)24(2,3)17-25(4,5)28-22/h8-9,11-15H,6,16-17H2,1-5H3 |
| InChIKey | GJVRJGXULUJAJV-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|