C29H34O3 — CID 69071707
ethyl 3-[3-[2-(2,2,4,4-tetramethyl-8-propan-2-yl-3H-chromen-6-yl)ethynyl]phenyl]prop-2-enoate (PubChem CID 69071707) has the molecular formula C29H34O3 and a molecular weight of 430.59 g/mol. Its IUPAC name is ethyl 3-[3-[2-(2,2,4,4-tetramethyl-8-propan-2-yl-3H-chromen-6-yl)ethynyl]phenyl]prop-2-enoate.
| Compound Name | ethyl 3-[3-[2-(2,2,4,4-tetramethyl-8-propan-2-yl-3H-chromen-6-yl)ethynyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 69071707 |
| Molecular Formula | C29H34O3 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | ethyl 3-[3-[2-(2,2,4,4-tetramethyl-8-propan-2-yl-3H-chromen-6-yl)ethynyl]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1cccc(C#Cc2cc(C(C)C)c3c(c2)C(C)(C)CC(C)(C)O3)c1 |
| InChI | InChI=1S/C29H34O3/c1-8-31-26(30)15-14-22-11-9-10-21(16-22)12-13-23-17-24(20(2)3)27-25(18-23)28(4,5)19-29(6,7)32-27/h9-11,14-18,20H,8,19H2,1-7H3 |
| InChIKey | XHEQVHPHSNNRMH-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|