C28H34O2 — CID 70183425
ethyl 3-[3-[1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)cyclopropyl]phenyl]prop-2-enoate (PubChem CID 70183425) has the molecular formula C28H34O2 and a molecular weight of 402.58 g/mol. Its IUPAC name is ethyl 3-[3-[1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)cyclopropyl]phenyl]prop-2-enoate.
| Compound Name | ethyl 3-[3-[1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)cyclopropyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 70183425 |
| Molecular Formula | C28H34O2 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | ethyl 3-[3-[1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)cyclopropyl]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1cccc(C2(c3ccc4c(c3)C(C)(C)CCC4(C)C)CC2)c1 |
| InChI | InChI=1S/C28H34O2/c1-6-30-25(29)13-10-20-8-7-9-21(18-20)28(16-17-28)22-11-12-23-24(19-22)27(4,5)15-14-26(23,2)3/h7-13,18-19H,6,14-17H2,1-5H3 |
| InChIKey | HCMAWKMVIFGJAF-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|