C16H20N2O2S — CID 76629815
ethyl 3-[3-(2-amino-4-methyl-5,6-dihydro-1,3-thiazin-4-yl)phenyl]prop-2-enoate (PubChem CID 76629815) has the molecular formula C16H20N2O2S and a molecular weight of 304.42 g/mol. Its IUPAC name is ethyl 3-[3-(2-amino-4-methyl-5,6-dihydro-1,3-thiazin-4-yl)phenyl]prop-2-enoate.
| Compound Name | ethyl 3-[3-(2-amino-4-methyl-5,6-dihydro-1,3-thiazin-4-yl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 76629815 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | ethyl 3-[3-(2-amino-4-methyl-5,6-dihydro-1,3-thiazin-4-yl)phenyl]prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1cccc(C2(C)CCSC(N)=N2)c1 |
| InChI | InChI=1S/C16H20N2O2S/c1-3-20-14(19)8-7-12-5-4-6-13(11-12)16(2)9-10-21-15(17)18-16/h4-8,11H,3,9-10H2,1-2H3,(H2,17,18) |
| InChIKey | MBZUHMJQLTXYDS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|