C28H36O2 — CID 21185883
ethyl (E)-3-[2-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethyl]phenyl]prop-2-enoate (PubChem CID 21185883) has the molecular formula C28H36O2 and a molecular weight of 404.59 g/mol. Its IUPAC name is ethyl (E)-3-[2-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethyl]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[2-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 21185883 |
| Molecular Formula | C28H36O2 |
| Molecular Weight | 404.59 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | ethyl (E)-3-[2-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethyl]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccccc1C(C)c1cc2c(cc1C)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C28H36O2/c1-8-30-26(29)14-13-21-11-9-10-12-22(21)20(3)23-18-25-24(17-19(23)2)27(4,5)15-16-28(25,6)7/h9-14,17-18,20H,8,15-16H2,1-7H3/b14-13+ |
| InChIKey | DSYUWAKLPOFXAS-BUHFOSPRSA-N |
| XLogP | 7.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.59 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|