C27H36O3Si — CID 54132228
ethyl 4-[2-(2,2,4,4-tetramethyl-3H-chromen-6-yl)-2-trimethylsilylethenyl]benzoate (PubChem CID 54132228) has the molecular formula C27H36O3Si and a molecular weight of 436.67 g/mol. Its IUPAC name is ethyl 4-[2-(2,2,4,4-tetramethyl-3H-chromen-6-yl)-2-trimethylsilylethenyl]benzoate.
| Compound Name | ethyl 4-[2-(2,2,4,4-tetramethyl-3H-chromen-6-yl)-2-trimethylsilylethenyl]benzoate |
|---|---|
| PubChem CID | 54132228 |
| Molecular Formula | C27H36O3Si |
| Molecular Weight | 436.67 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | ethyl 4-[2-(2,2,4,4-tetramethyl-3H-chromen-6-yl)-2-trimethylsilylethenyl]benzoate |
| SMILES | CCOC(=O)c1ccc(C=C(c2ccc3c(c2)C(C)(C)CC(C)(C)O3)[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C27H36O3Si/c1-9-29-25(28)20-12-10-19(11-13-20)16-24(31(6,7)8)21-14-15-23-22(17-21)26(2,3)18-27(4,5)30-23/h10-17H,9,18H2,1-8H3 |
| InChIKey | NVEAWVODZFRCJW-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.67 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|