C26H32O5 — CID 54143301
(4-propoxycarbonylphenyl) 7-ethyl-2,2,4,4-tetramethyl-3H-chromene-6-carboxylate (PubChem CID 54143301) has the molecular formula C26H32O5 and a molecular weight of 424.54 g/mol. Its IUPAC name is (4-propoxycarbonylphenyl) 7-ethyl-2,2,4,4-tetramethyl-3H-chromene-6-carboxylate.
| Compound Name | (4-propoxycarbonylphenyl) 7-ethyl-2,2,4,4-tetramethyl-3H-chromene-6-carboxylate |
|---|---|
| PubChem CID | 54143301 |
| Molecular Formula | C26H32O5 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | (4-propoxycarbonylphenyl) 7-ethyl-2,2,4,4-tetramethyl-3H-chromene-6-carboxylate |
| SMILES | CCCOC(=O)c1ccc(OC(=O)c2cc3c(cc2CC)OC(C)(C)CC3(C)C)cc1 |
| InChI | InChI=1S/C26H32O5/c1-7-13-29-23(27)18-9-11-19(12-10-18)30-24(28)20-15-21-22(14-17(20)8-2)31-26(5,6)16-25(21,3)4/h9-12,14-15H,7-8,13,16H2,1-6H3 |
| InChIKey | OCPGJHZSKHFJKW-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|