C27H36O4 — CID 10137188
4-[2-(2,2,4,4-tetramethyl-3H-chromen-6-yl)heptoxy]benzoic acid (PubChem CID 10137188) has the molecular formula C27H36O4 and a molecular weight of 424.58 g/mol. Its IUPAC name is 4-[2-(2,2,4,4-tetramethyl-3H-chromen-6-yl)heptoxy]benzoic acid.
| Compound Name | 4-[2-(2,2,4,4-tetramethyl-3H-chromen-6-yl)heptoxy]benzoic acid |
|---|---|
| PubChem CID | 10137188 |
| Molecular Formula | C27H36O4 |
| Molecular Weight | 424.58 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | 4-[2-(2,2,4,4-tetramethyl-3H-chromen-6-yl)heptoxy]benzoic acid |
| SMILES | CCCCCC(COc1ccc(C(=O)O)cc1)c1ccc2c(c1)C(C)(C)CC(C)(C)O2 |
| InChI | InChI=1S/C27H36O4/c1-6-7-8-9-21(17-30-22-13-10-19(11-14-22)25(28)29)20-12-15-24-23(16-20)26(2,3)18-27(4,5)31-24/h10-16,21H,6-9,17-18H2,1-5H3,(H,28,29) |
| InChIKey | DWAMPLHQCKUNEV-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.58 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|