C21H36O3Si2 — CID 67854194
4-[1-(2,2,3,6,6-pentamethyloxadisilinan-3-yl)hexyl]benzoic acid (PubChem CID 67854194) has the molecular formula C21H36O3Si2 and a molecular weight of 392.69 g/mol. Its IUPAC name is 4-[1-(2,2,3,6,6-pentamethyloxadisilinan-3-yl)hexyl]benzoic acid.
| Compound Name | 4-[1-(2,2,3,6,6-pentamethyloxadisilinan-3-yl)hexyl]benzoic acid |
|---|---|
| PubChem CID | 67854194 |
| Molecular Formula | C21H36O3Si2 |
| Molecular Weight | 392.69 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 4-[1-(2,2,3,6,6-pentamethyloxadisilinan-3-yl)hexyl]benzoic acid |
| SMILES | CCCCCC(c1ccc(C(=O)O)cc1)[Si]1(C)CCC(C)(C)O[Si]1(C)C |
| InChI | InChI=1S/C21H36O3Si2/c1-7-8-9-10-19(17-11-13-18(14-12-17)20(22)23)26(6)16-15-21(2,3)24-25(26,4)5/h11-14,19H,7-10,15-16H2,1-6H3,(H,22,23) |
| InChIKey | CPBSRCLWHDXGJQ-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.69 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|