C32H44N2O3S — CID 67789349
5-[5-[2-(7-hexylsulfanyl-2,2,4,4-tetramethyl-3H-chromen-6-yl)ethynyl]pyrimidin-2-yl]heptanoic acid (PubChem CID 67789349) has the molecular formula C32H44N2O3S and a molecular weight of 536.78 g/mol. Its IUPAC name is 5-[5-[2-(7-hexylsulfanyl-2,2,4,4-tetramethyl-3H-chromen-6-yl)ethynyl]pyrimidin-2-yl]heptanoic acid.
| Compound Name | 5-[5-[2-(7-hexylsulfanyl-2,2,4,4-tetramethyl-3H-chromen-6-yl)ethynyl]pyrimidin-2-yl]heptanoic acid |
|---|---|
| PubChem CID | 67789349 |
| Molecular Formula | C32H44N2O3S |
| Molecular Weight | 536.78 g/mol |
| Exact Mass | 536.31 |
| IUPAC Name | 5-[5-[2-(7-hexylsulfanyl-2,2,4,4-tetramethyl-3H-chromen-6-yl)ethynyl]pyrimidin-2-yl]heptanoic acid |
| SMILES | CCCCCCSc1cc2c(cc1C#Cc1cnc(C(CC)CCCC(=O)O)nc1)C(C)(C)CC(C)(C)O2 |
| InChI | InChI=1S/C32H44N2O3S/c1-7-9-10-11-17-38-28-19-27-26(31(3,4)22-32(5,6)37-27)18-25(28)16-15-23-20-33-30(34-21-23)24(8-2)13-12-14-29(35)36/h18-21,24H,7-14,17,22H2,1-6H3,(H,35,36) |
| InChIKey | RBQYRBBDAKIFAC-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.78 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|