C27H34N2O3S — CID 57264326
ethyl 2-[6-[2-(7-hexylsulfanyl-4,4-dimethyl-2,3-dihydrochromen-6-yl)ethynyl]pyridazin-3-yl]acetate (PubChem CID 57264326) has the molecular formula C27H34N2O3S and a molecular weight of 466.65 g/mol. Its IUPAC name is ethyl 2-[6-[2-(7-hexylsulfanyl-4,4-dimethyl-2,3-dihydrochromen-6-yl)ethynyl]pyridazin-3-yl]acetate.
| Compound Name | ethyl 2-[6-[2-(7-hexylsulfanyl-4,4-dimethyl-2,3-dihydrochromen-6-yl)ethynyl]pyridazin-3-yl]acetate |
|---|---|
| PubChem CID | 57264326 |
| Molecular Formula | C27H34N2O3S |
| Molecular Weight | 466.65 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | ethyl 2-[6-[2-(7-hexylsulfanyl-4,4-dimethyl-2,3-dihydrochromen-6-yl)ethynyl]pyridazin-3-yl]acetate |
| SMILES | CCCCCCSc1cc2c(cc1C#Cc1ccc(CC(=O)OCC)nn1)C(C)(C)CCO2 |
| InChI | InChI=1S/C27H34N2O3S/c1-5-7-8-9-16-33-25-19-24-23(27(3,4)14-15-32-24)17-20(25)10-11-21-12-13-22(29-28-21)18-26(30)31-6-2/h12-13,17,19H,5-9,14-16,18H2,1-4H3 |
| InChIKey | QBBJFXXRBFFQRI-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.65 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|