C25H30N2O3S3 — CID 57024974
ethyl 5-[6-[2-[4,4,7-tris(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]pyridazin-3-yl]pentanoate (PubChem CID 57024974) has the molecular formula C25H30N2O3S3 and a molecular weight of 502.73 g/mol. Its IUPAC name is ethyl 5-[6-[2-[4,4,7-tris(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]pyridazin-3-yl]pentanoate.
| Compound Name | ethyl 5-[6-[2-[4,4,7-tris(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]pyridazin-3-yl]pentanoate |
|---|---|
| PubChem CID | 57024974 |
| Molecular Formula | C25H30N2O3S3 |
| Molecular Weight | 502.73 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | ethyl 5-[6-[2-[4,4,7-tris(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]pyridazin-3-yl]pentanoate |
| SMILES | CCOC(=O)CCCCc1ccc(C#Cc2cc3c(cc2SC)OCCC3(SC)SC)nn1 |
| InChI | InChI=1S/C25H30N2O3S3/c1-5-29-24(28)9-7-6-8-19-12-13-20(27-26-19)11-10-18-16-21-22(17-23(18)31-2)30-15-14-25(21,32-3)33-4/h12-13,16-17H,5-9,14-15H2,1-4H3 |
| InChIKey | NLTPUJCQRIUVII-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.73 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|