C27H34N2O3S — CID 57310004
ethyl 5-[5-[2-(4,4-diethyl-7-methylsulfanyl-2,3-dihydrochromen-6-yl)ethynyl]pyrimidin-2-yl]pentanoate (PubChem CID 57310004) has the molecular formula C27H34N2O3S and a molecular weight of 466.65 g/mol. Its IUPAC name is ethyl 5-[5-[2-(4,4-diethyl-7-methylsulfanyl-2,3-dihydrochromen-6-yl)ethynyl]pyrimidin-2-yl]pentanoate.
| Compound Name | ethyl 5-[5-[2-(4,4-diethyl-7-methylsulfanyl-2,3-dihydrochromen-6-yl)ethynyl]pyrimidin-2-yl]pentanoate |
|---|---|
| PubChem CID | 57310004 |
| Molecular Formula | C27H34N2O3S |
| Molecular Weight | 466.65 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | ethyl 5-[5-[2-(4,4-diethyl-7-methylsulfanyl-2,3-dihydrochromen-6-yl)ethynyl]pyrimidin-2-yl]pentanoate |
| SMILES | CCOC(=O)CCCCc1ncc(C#Cc2cc3c(cc2SC)OCCC3(CC)CC)cn1 |
| InChI | InChI=1S/C27H34N2O3S/c1-5-27(6-2)14-15-32-23-17-24(33-4)21(16-22(23)27)13-12-20-18-28-25(29-19-20)10-8-9-11-26(30)31-7-3/h16-19H,5-11,14-15H2,1-4H3 |
| InChIKey | PRBWNSIYGQTFRT-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.65 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|