C25H30N2O3 — CID 18961779
ethyl 5-[4-[2-(4,4,7-trimethyl-2,3-dihydrochromen-6-yl)ethynyl]pyrimidin-2-yl]pentanoate (PubChem CID 18961779) has the molecular formula C25H30N2O3 and a molecular weight of 406.53 g/mol. Its IUPAC name is ethyl 5-[4-[2-(4,4,7-trimethyl-2,3-dihydrochromen-6-yl)ethynyl]pyrimidin-2-yl]pentanoate.
| Compound Name | ethyl 5-[4-[2-(4,4,7-trimethyl-2,3-dihydrochromen-6-yl)ethynyl]pyrimidin-2-yl]pentanoate |
|---|---|
| PubChem CID | 18961779 |
| Molecular Formula | C25H30N2O3 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | ethyl 5-[4-[2-(4,4,7-trimethyl-2,3-dihydrochromen-6-yl)ethynyl]pyrimidin-2-yl]pentanoate |
| SMILES | CCOC(=O)CCCCc1nccc(C#Cc2cc3c(cc2C)OCCC3(C)C)n1 |
| InChI | InChI=1S/C25H30N2O3/c1-5-29-24(28)9-7-6-8-23-26-14-12-20(27-23)11-10-19-17-21-22(16-18(19)2)30-15-13-25(21,3)4/h12,14,16-17H,5-9,13,15H2,1-4H3 |
| InChIKey | XQXPFUKXKMSLCX-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|