C26H32N2O3 — CID 19975561
ethyl 5-[6-[2-(7-ethyl-4,4-dimethyl-2,3-dihydrochromen-6-yl)ethynyl]pyridazin-3-yl]pentanoate (PubChem CID 19975561) has the molecular formula C26H32N2O3 and a molecular weight of 420.55 g/mol. Its IUPAC name is ethyl 5-[6-[2-(7-ethyl-4,4-dimethyl-2,3-dihydrochromen-6-yl)ethynyl]pyridazin-3-yl]pentanoate.
| Compound Name | ethyl 5-[6-[2-(7-ethyl-4,4-dimethyl-2,3-dihydrochromen-6-yl)ethynyl]pyridazin-3-yl]pentanoate |
|---|---|
| PubChem CID | 19975561 |
| Molecular Formula | C26H32N2O3 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | ethyl 5-[6-[2-(7-ethyl-4,4-dimethyl-2,3-dihydrochromen-6-yl)ethynyl]pyridazin-3-yl]pentanoate |
| SMILES | CCOC(=O)CCCCc1ccc(C#Cc2cc3c(cc2CC)OCCC3(C)C)nn1 |
| InChI | InChI=1S/C26H32N2O3/c1-5-19-18-24-23(26(3,4)15-16-31-24)17-20(19)11-12-22-14-13-21(27-28-22)9-7-8-10-25(29)30-6-2/h13-14,17-18H,5-10,15-16H2,1-4H3 |
| InChIKey | AKPYWGLOOVIXCP-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|